Products 615-08-7
CAS 615-08-7 appears in our catalog under these names: Furan-2-carboxylic anhydride 98%, 2-Furancarboxylic acid, 2,2'-anhydride, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Furan-2-carbonyl furan-2-carboxylate (CAS 615-08-7) is a chemical compound with the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. IUPAC name: furan-2-carbonyl furan-2-carboxylate. InChIKey: KCENQZYGMHVBJH-UHFFFAOYSA-N.
| Molecular formula | C10H6O5 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | furan-2-carbonyl furan-2-carboxylate |
| InChIKey | KCENQZYGMHVBJH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)OC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)