Products 1728-89-8

CAS 1728-89-8 appears in our catalog under these names: 8-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid 97%, 8-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid, 95%, 95%, 8-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

8-hydroxy-2-oxochromene-3-carboxylic acid (CAS 1728-89-8) is a chemical compound with the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. IUPAC name: 8-hydroxy-2-oxochromene-3-carboxylic acid. InChIKey: QIBIAGDWRHWFNP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6O5
Molecular weight206.15 g/mol
IUPAC name8-hydroxy-2-oxochromene-3-carboxylic acid
InChIKeyQIBIAGDWRHWFNP-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)O)OC(=O)C(=C2)C(=O)O

Computed by PubChem (NCBI)