CAS 53878-47-0 is the registry number for 5-hydroxy-4-oxo-4H-chromene-2-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 2,5g.
5-hydroxy-4-oxochromene-2-carboxylic acid (CAS 53878-47-0) is a chemical compound with the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. IUPAC name: 5-hydroxy-4-oxochromene-2-carboxylic acid. InChIKey: WXAWTEGETBBUTP-UHFFFAOYSA-N.
| Molecular formula | C10H6O5 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 5-hydroxy-4-oxochromene-2-carboxylic acid |
| InChIKey | WXAWTEGETBBUTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C(=O)O)O |
Computed by PubChem (NCBI)