Products 53878-47-0

CAS 53878-47-0 is the registry number for 5-hydroxy-4-oxo-4H-chromene-2-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

5-hydroxy-4-oxochromene-2-carboxylic acid (CAS 53878-47-0) is a chemical compound with the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. IUPAC name: 5-hydroxy-4-oxochromene-2-carboxylic acid. InChIKey: WXAWTEGETBBUTP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6O5
Molecular weight206.15 g/mol
IUPAC name5-hydroxy-4-oxochromene-2-carboxylic acid
InChIKeyWXAWTEGETBBUTP-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)OC(=CC2=O)C(=O)O)O

Computed by PubChem (NCBI)