CAS 131023-44-4 appears in our catalog under these names: Diclofenac Impurity 23, 8-Chlorocarbazole-1-acetic Acid, >95% (HPLC), 2-(8-Chloro-9H-carbazol-1-yl)acetic acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 0,025g.
2-(8-chloro-9H-carbazol-1-yl)acetic acid (CAS 131023-44-4) is a chemical compound with the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. IUPAC name: 2-(8-chloro-9H-carbazol-1-yl)acetic acid. InChIKey: NUTYGMIYEFIHFA-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-(8-chloro-9H-carbazol-1-yl)acetic acid |
| InChIKey | NUTYGMIYEFIHFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)C3=C(N2)C(=CC=C3)Cl)CC(=O)O |
Computed by PubChem (NCBI)