CAS 74732-00-6 appears in our catalog under these names: N-(2-chloroethyl)-1,8-naphthalimide, 98%, N-(2-chloroethyl)-1,8-naphthalimide, 97%, 97%, 2-(2-Chloroethyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg, 1g, 5g.
2-(2-chloroethyl)benzo[de]isoquinoline-1,3-dione (CAS 74732-00-6) is a chemical compound with the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. IUPAC name: 2-(2-chloroethyl)benzo[de]isoquinoline-1,3-dione. InChIKey: AWVXDWQRGJLTBI-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-(2-chloroethyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | AWVXDWQRGJLTBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCCl |
Computed by PubChem (NCBI)