CAS 855752-70-4 appears in our catalog under these names: 2-Chloro-n-dibenzo[b,d]furan-3-ylacetamide, 95%, 2-Chloro-N-(dibenzo(b,d)furan-3-yl)acetamide, 95-<97%, 2-Chloro-N-(dibenzo(b,d)furan-3-yl)acetamide, ≥97-<99%, 2-Chloro-N-(dibenzo(b,d)furan-3-yl)acetamide, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 50g, 100g.
2-chloro-N-dibenzofuran-3-ylacetamide (CAS 855752-70-4) is a chemical compound with the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. IUPAC name: 2-chloro-N-dibenzofuran-3-ylacetamide. InChIKey: BKVOMTTWZLOIDK-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-chloro-N-dibenzofuran-3-ylacetamide |
| InChIKey | BKVOMTTWZLOIDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)NC(=O)CCl |
Computed by PubChem (NCBI)