Products 160784-78-1
CAS 160784-78-1 is the registry number for N-(2-Chlorophenyl)-2-oxo-2-phenylacetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(2-chlorophenyl)-2-oxo-2-phenylacetamide (CAS 160784-78-1) is a chemical compound with the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. IUPAC name: N-(2-chlorophenyl)-2-oxo-2-phenylacetamide. InChIKey: WSHGURBIJSHTKJ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | N-(2-chlorophenyl)-2-oxo-2-phenylacetamide |
| InChIKey | WSHGURBIJSHTKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)NC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)