Products 1310404-19-3
CAS 1310404-19-3 is the registry number for tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate. Offered by: Biosynth. Available pack sizes: 10g, 1g.
Tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1310404-19-3) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: RYGQTNJVJYIYIF-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | RYGQTNJVJYIYIF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)