CAS 131057-63-1 appears in our catalog under these names: 5-Ethoxy-1,3-dimethylindolin-2-one, 95%, 5-Ethoxy-1,3-dimethylindolin-2-one, 95+%, 5–Ethoxy–1,3–dimethyl–1,3–dihydro–indol–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-ethoxy-1,3-dimethyl-3H-indol-2-one (CAS 131057-63-1) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 5-ethoxy-1,3-dimethyl-3H-indol-2-one. InChIKey: JMRWLRFPUMZEGA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 5-ethoxy-1,3-dimethyl-3H-indol-2-one |
| InChIKey | JMRWLRFPUMZEGA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N(C(=O)C2C)C |
Computed by PubChem (NCBI)