CAS 1310676-34-6 appears in our catalog under these names: rac-trans-N-Desmethyl sertraline hydrochloride, rac-trans-N-Desmethyl sertraline hydroch, loride, 1 mg, rac-trans-N-Desmethyl sertraline hydroch, loride, 2 mg, rac-trans-N-Desmethyl sertraline hydroch, loride, 5 mg, rac-trans-N-Desmethyl sertraline hydroch, loride, 10 mg. Offered by: Biosynth, Roth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1310676-34-6) is a chemical compound with the molecular formula C16H16Cl3N and a molecular weight of 328.7 g/mol. IUPAC name: (1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: YKXHIERZIRLOLD-DFIJPDEKSA-N.
| Molecular formula | C16H16Cl3N |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | (1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | YKXHIERZIRLOLD-DFIJPDEKSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2[C@@H]1C3=CC(=C(C=C3)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)