Products 1310720-83-2
CAS 1310720-83-2 appears in our catalog under these names: Methyl 2-(4-(dimethylamino)phenyl)-2-hydroxyacetate, 97%, Methyl 4-(dimethylamino)-α-hydroxybenzeneacetate, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-[4-(dimethylamino)phenyl]-2-hydroxyacetate (CAS 1310720-83-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl 2-[4-(dimethylamino)phenyl]-2-hydroxyacetate. InChIKey: SFHJOPXATJMAJA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | methyl 2-[4-(dimethylamino)phenyl]-2-hydroxyacetate |
| InChIKey | SFHJOPXATJMAJA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C(=O)OC)O |
Computed by PubChem (NCBI)