CAS 131090-44-3 is the registry number for 5-((4-Nitrophenyl)methyl)-1H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(4-nitrophenyl)methyl]-2H-tetrazole (CAS 131090-44-3) is a chemical compound with the molecular formula C8H7N5O2 and a molecular weight of 205.17 g/mol. IUPAC name: 5-[(4-nitrophenyl)methyl]-2H-tetrazole. InChIKey: IFCSVRFWBHAENG-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-[(4-nitrophenyl)methyl]-2H-tetrazole |
| InChIKey | IFCSVRFWBHAENG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NNN=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)