CAS 1310923-26-2 appears in our catalog under these names: (S)-(4-Chlorophenyl)(cyclopropyl)methanamine hydrochloride, 98%, (S)-(4-Chlorophenyl)(cyclopropyl)methanamine hydrochloride, ≥97%, ≥97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
(S)-(4-chlorophenyl)-cyclopropylmethanamine;hydrochloride (CAS 1310923-26-2) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (S)-(4-chlorophenyl)-cyclopropylmethanamine;hydrochloride. InChIKey: IYHHCTOKERFDLT-PPHPATTJSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (S)-(4-chlorophenyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | IYHHCTOKERFDLT-PPHPATTJSA-N |
| SMILES | C1CC1[C@@H](C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)