CAS 1311265-07-2 is the registry number for 6-Bromo-3,3-dimethylchroman-4-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3,3-dimethyl-2H-chromen-4-one (CAS 1311265-07-2) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2H-chromen-4-one. InChIKey: SCPBADMWOXMTBN-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2H-chromen-4-one |
| InChIKey | SCPBADMWOXMTBN-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(C1=O)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)