Products 1311271-71-2
CAS 1311271-71-2 is the registry number for SARS-CoV-2-IN-44. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2Z)-6-(methoxymethoxy)-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one (CAS 1311271-71-2) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: (2Z)-6-(methoxymethoxy)-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one. InChIKey: POMVJOWASPZFJH-MFOYZWKCSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | (2Z)-6-(methoxymethoxy)-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| InChIKey | POMVJOWASPZFJH-MFOYZWKCSA-N |
| SMILES | COCOC1=CC2=C(C=C1)C(=O)/C(=C/C3=CC=C(C=C3)OC)/O2 |
Computed by PubChem (NCBI)