CAS 1311313-86-6 appears in our catalog under these names: 3-Amino-1,5-dimethyl-2,3-dihydro-1H-indol-2-one dihydrochloride, 95%, 3-Amino-1,5-dimethyl-2,3-dihydro-1H-indol-2-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-amino-1,5-dimethyl-3H-indol-2-one;dihydrochloride (CAS 1311313-86-6) is a chemical compound with the molecular formula C10H14Cl2N2O and a molecular weight of 249.13 g/mol. IUPAC name: 3-amino-1,5-dimethyl-3H-indol-2-one;dihydrochloride. InChIKey: FYYXADPKTWFPHN-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 3-amino-1,5-dimethyl-3H-indol-2-one;dihydrochloride |
| InChIKey | FYYXADPKTWFPHN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)C2N)C.Cl.Cl |
Computed by PubChem (NCBI)