Products 1432681-35-0
CAS 1432681-35-0 appears in our catalog under these names: 2-(Aminomethyl)-5,6,7,8-tetrahydroquinolin-5-one dihydrochloride, 95%, 2-(Aminomethyl)-5,6,7,8-tetrahydroquinolin-5-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(aminomethyl)-7,8-dihydro-6H-quinolin-5-one;dihydrochloride (CAS 1432681-35-0) is a chemical compound with the molecular formula C10H14Cl2N2O and a molecular weight of 249.13 g/mol. IUPAC name: 2-(aminomethyl)-7,8-dihydro-6H-quinolin-5-one;dihydrochloride. InChIKey: HKDBHEMJRXORSS-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 2-(aminomethyl)-7,8-dihydro-6H-quinolin-5-one;dihydrochloride |
| InChIKey | HKDBHEMJRXORSS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=N2)CN)C(=O)C1.Cl.Cl |
Computed by PubChem (NCBI)