CAS 1803583-70-1 appears in our catalog under these names: 2-(4-Methyl-1,3-benzoxazol-2-yl)ethan-1-amine dihydrochloride, 95%, 2-(4-Methyl-1,3-benzoxazol-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(4-methyl-1,3-benzoxazol-2-yl)ethanamine;dihydrochloride (CAS 1803583-70-1) is a chemical compound with the molecular formula C10H14Cl2N2O and a molecular weight of 249.13 g/mol. IUPAC name: 2-(4-methyl-1,3-benzoxazol-2-yl)ethanamine;dihydrochloride. InChIKey: QHVMZOWXJABPKG-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 2-(4-methyl-1,3-benzoxazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | QHVMZOWXJABPKG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)