Products 252334-30-8
CAS 252334-30-8 is the registry number for 3,5-Bis(chloromethyl)-1-(oxan-2-yl)pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,5-bis(chloromethyl)-1-(oxan-2-yl)pyrazole (CAS 252334-30-8) is a chemical compound with the molecular formula C10H14Cl2N2O and a molecular weight of 249.13 g/mol. IUPAC name: 3,5-bis(chloromethyl)-1-(oxan-2-yl)pyrazole. InChIKey: VBGWHOMQIHLKKL-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 3,5-bis(chloromethyl)-1-(oxan-2-yl)pyrazole |
| InChIKey | VBGWHOMQIHLKKL-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C(=CC(=N2)CCl)CCl |
Computed by PubChem (NCBI)