CAS 1311315-29-3 appears in our catalog under these names: 5-Amino-6,7,8,9-tetrahydro-5H-benzo(7)annulene-5-carboxylic acid hydrochloride, 95%, 5-Amino-6,7,8,9-tetrahydro-5H-benzo(7)annulene-5-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-amino-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid;hydrochloride (CAS 1311315-29-3) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 5-amino-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid;hydrochloride. InChIKey: UHYFKZRLDRSNGL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 5-amino-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid;hydrochloride |
| InChIKey | UHYFKZRLDRSNGL-UHFFFAOYSA-N |
| SMILES | C1CCC(C2=CC=CC=C2C1)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)