Products 1817630-90-2
CAS 1817630-90-2 is the registry number for (3R,5R)-3-Fluoro-5-(hydroxymethyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-3-fluoro-5-(hydroxymethyl)pyrrolidin-2-one (CAS 1817630-90-2) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (3R,5R)-3-fluoro-5-(hydroxymethyl)pyrrolidin-2-one. InChIKey: MEFURQKDWBGYNF-QWWZWVQMSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (3R,5R)-3-fluoro-5-(hydroxymethyl)pyrrolidin-2-one |
| InChIKey | MEFURQKDWBGYNF-QWWZWVQMSA-N |
| SMILES | C1[C@@H](NC(=O)[C@@H]1F)CO |
Computed by PubChem (NCBI)