CAS 6745-32-0 is the registry number for rel–((2S,4R)–4–Fluoropyrrolidine–2–carboxylic acid),labeled with tritium. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S,4S)-4-fluoropyrrolidine-2-carboxylic acid (CAS 6745-32-0) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2S,4S)-4-fluoropyrrolidine-2-carboxylic acid. InChIKey: ZIWHMENIDGOELV-IMJSIDKUSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2S,4S)-4-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | ZIWHMENIDGOELV-IMJSIDKUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)F |
Computed by PubChem (NCBI)