CAS 1311856-66-2 appears in our catalog under these names: 4-(3-Chlorophenyl)-3-methyl-2,5-dihydro-1,2-oxazol-5-imine, 95%, 4-(3-Chlorophenyl)-3-methyl-2,5-dihydro-1,2-oxazol-5-imine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-(3-chlorophenyl)-3-methyl-1,2-oxazol-5-amine (CAS 1311856-66-2) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 4-(3-chlorophenyl)-3-methyl-1,2-oxazol-5-amine. InChIKey: FPZYVCHIGUSBEM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-3-methyl-1,2-oxazol-5-amine |
| InChIKey | FPZYVCHIGUSBEM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)