CAS 1312138-71-8 appears in our catalog under these names: 3-(6-Chloro-1-isopropyl-1h-benzimidazol-2-yl)propanoic acid, 95%, 3-(6-Chloro-1-isopropyl-1H-benzimidazol-2-yl)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg, 5000mg.
3-(6-chloro-1-propan-2-ylbenzimidazol-2-yl)propanoic acid (CAS 1312138-71-8) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: 3-(6-chloro-1-propan-2-ylbenzimidazol-2-yl)propanoic acid. InChIKey: FFSWMWJFVCCBSS-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 3-(6-chloro-1-propan-2-ylbenzimidazol-2-yl)propanoic acid |
| InChIKey | FFSWMWJFVCCBSS-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=CC(=C2)Cl)N=C1CCC(=O)O |
Computed by PubChem (NCBI)