CAS 1312325-09-9 is the registry number for 2-(Thiazol-4-yl)-1H-imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-thiazol-4-yl)-1H-imidazole-5-carbaldehyde (CAS 1312325-09-9) is a chemical compound with the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. IUPAC name: 2-(1,3-thiazol-4-yl)-1H-imidazole-5-carbaldehyde. InChIKey: QWPCNGCRUVJUEV-UHFFFAOYSA-N.
| Molecular formula | C7H5N3OS |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 2-(1,3-thiazol-4-yl)-1H-imidazole-5-carbaldehyde |
| InChIKey | QWPCNGCRUVJUEV-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)C2=CSC=N2)C=O |
Computed by PubChem (NCBI)