CAS 1334147-08-8 appears in our catalog under these names: 3-(Pyridin-2-yl)-1,2,4-oxadiazole-5-thiol, 95%, 3-(Pyridin-2-yl)-1,2,4-oxadiazole-5-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-pyridin-2-yl-2H-1,2,4-oxadiazole-5-thione (CAS 1334147-08-8) is a chemical compound with the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. IUPAC name: 3-pyridin-2-yl-2H-1,2,4-oxadiazole-5-thione. InChIKey: IRSOKBPWRNAWAX-UHFFFAOYSA-N.
| Molecular formula | C7H5N3OS |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 3-pyridin-2-yl-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | IRSOKBPWRNAWAX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=S)ON2 |
Computed by PubChem (NCBI)