CAS 3690-46-8 appears in our catalog under these names: 5–(Pyridin–3–yl)–1,3,4–oxadiazole–2–thiol, 5-(Pyridin-3-yl)-1,3,4-oxadiazole-2-thiol 95%, 5-(3-PYRIDYL)-1,3,4-OXADIAZOLE-2-THIOL,, 5-(pyridin-3-yl)-2,3-dihydro-1,3,4-oxadiazole-2-thione, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-pyridin-3-yl-3H-1,3,4-oxadiazole-2-thione (CAS 3690-46-8) is a chemical compound with the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. IUPAC name: 5-pyridin-3-yl-3H-1,3,4-oxadiazole-2-thione. InChIKey: QBLWWQDTKCIRSW-UHFFFAOYSA-N.
| Molecular formula | C7H5N3OS |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 5-pyridin-3-yl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | QBLWWQDTKCIRSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)