CAS 3690-47-9 is the registry number for 5-Pyridin-2-yl-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-pyridin-2-yl-3H-1,3,4-oxadiazole-2-thione (CAS 3690-47-9) is a chemical compound with the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. IUPAC name: 5-pyridin-2-yl-3H-1,3,4-oxadiazole-2-thione. InChIKey: KXNWRPICZLNODY-UHFFFAOYSA-N.
| Molecular formula | C7H5N3OS |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 5-pyridin-2-yl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | KXNWRPICZLNODY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)