Products 1312690-33-7
CAS 1312690-33-7 is the registry number for 5-(Ethoxycarbonyl)-3-methyl-1H-indole-2-carboxylic acid, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
5-ethoxycarbonyl-3-methyl-1H-indole-2-carboxylic acid (CAS 1312690-33-7) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 5-ethoxycarbonyl-3-methyl-1H-indole-2-carboxylic acid. InChIKey: JQJXPLZQZQGFDQ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 5-ethoxycarbonyl-3-methyl-1H-indole-2-carboxylic acid |
| InChIKey | JQJXPLZQZQGFDQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2C)C(=O)O |
Computed by PubChem (NCBI)