Products 1312703-30-2
CAS 1312703-30-2 appears in our catalog under these names: Dimethyl 2'-amino-1,1':4,1''-terphenyl-4,4''-dicarboxylate, 95%, Dimethyl 2'-amino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylate 98%, [1,1'':4'',1''''-Terphenyl]-4,4''''-dicarboxylic acid, 2''-amino-, 4,4''''-dimethyl ester, 95%, 95%, Dimethyl 2'-amino-[1,1',4',1''-terphenyl]-4,4''-dicarboxylate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 4-[3-amino-4-(4-methoxycarbonylphenyl)phenyl]benzoate (CAS 1312703-30-2) is a chemical compound with the molecular formula C22H19NO4 and a molecular weight of 361.4 g/mol. IUPAC name: methyl 4-[3-amino-4-(4-methoxycarbonylphenyl)phenyl]benzoate. InChIKey: WYBXIMMFDVNQOV-UHFFFAOYSA-N.
| Molecular formula | C22H19NO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | methyl 4-[3-amino-4-(4-methoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | WYBXIMMFDVNQOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=C(C=C3)C(=O)OC)N |
Computed by PubChem (NCBI)