Products 152699-63-3
CAS 152699-63-3 appears in our catalog under these names: Dibenzyl 5-aminoisophthalate, 95%, Dibenzyl 5-aminoisophthalate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg.
Dibenzyl 5-aminobenzene-1,3-dicarboxylate (CAS 152699-63-3) is a chemical compound with the molecular formula C22H19NO4 and a molecular weight of 361.4 g/mol. IUPAC name: dibenzyl 5-aminobenzene-1,3-dicarboxylate. InChIKey: VDJWRMQQXQBYIO-UHFFFAOYSA-N.
| Molecular formula | C22H19NO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | dibenzyl 5-aminobenzene-1,3-dicarboxylate |
| InChIKey | VDJWRMQQXQBYIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC(=C2)N)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)