CAS 326907-60-2 is the registry number for 3-[2-(3,4-dimethoxyphenyl)ethyl]-3-azatricyclo[7.3.1.0^{5,13}]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-[2-(3,4-dimethoxyphenyl)ethyl]benzo[de]isoquinoline-1,3-dione (CAS 326907-60-2) is a chemical compound with the molecular formula C22H19NO4 and a molecular weight of 361.4 g/mol. IUPAC name: 2-[2-(3,4-dimethoxyphenyl)ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: WCNMCXFYJFXICQ-UHFFFAOYSA-N.
| Molecular formula | C22H19NO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 2-[2-(3,4-dimethoxyphenyl)ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | WCNMCXFYJFXICQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCN2C(=O)C3=CC=CC4=C3C(=CC=C4)C2=O)OC |
Computed by PubChem (NCBI)