CAS 1699-54-3 is the registry number for 3,4-Dibenzyloxy-trans-beta-nitrostyrene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(E)-2-nitroethenyl]-1,2-bis(phenylmethoxy)benzene (CAS 1699-54-3) is a chemical compound with the molecular formula C22H19NO4 and a molecular weight of 361.4 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]-1,2-bis(phenylmethoxy)benzene. InChIKey: CHTJRVASYXOBSO-BUHFOSPRSA-N.
| Molecular formula | C22H19NO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]-1,2-bis(phenylmethoxy)benzene |
| InChIKey | CHTJRVASYXOBSO-BUHFOSPRSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)/C=C/[N+](=O)[O-])OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)