Products 1312714-92-3
CAS 1312714-92-3 is the registry number for 1,1-Dimethylethyl N-[(1S)-1-methyl-3-butyn-1-yl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Tert-butyl N-[(2S)-pent-4-yn-2-yl]carbamate (CAS 1312714-92-3) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: tert-butyl N-[(2S)-pent-4-yn-2-yl]carbamate. InChIKey: BKIXNAMQZXSUPU-QMMMGPOBSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | tert-butyl N-[(2S)-pent-4-yn-2-yl]carbamate |
| InChIKey | BKIXNAMQZXSUPU-QMMMGPOBSA-N |
| SMILES | C[C@@H](CC#C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)