CAS 13128-74-0 is the registry number for 4,4-Diphenylcyclohexane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-diphenylcyclohexane-1,3-dione (CAS 13128-74-0) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 4,4-diphenylcyclohexane-1,3-dione. InChIKey: RMNXDIURPRSSPG-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 4,4-diphenylcyclohexane-1,3-dione |
| InChIKey | RMNXDIURPRSSPG-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)CC1=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)