CAS 1312949-21-5 is the registry number for 5-(Boc-amino)-3-chloro-1-methyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-(3-chloro-1-methylpyrazol-5-yl)carbamate (CAS 1312949-21-5) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: tert-butyl N-(3-chloro-1-methylpyrazol-5-yl)carbamate. InChIKey: QZGMVMPHSSPPJN-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O2 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-1-methylpyrazol-5-yl)carbamate |
| InChIKey | QZGMVMPHSSPPJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NN1C)Cl |
Computed by PubChem (NCBI)