Products 52289-07-3

CAS 52289-07-3 is the registry number for N-(3-Aminopropyl)-2-nitroaniline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

N'-(2-nitrophenyl)propane-1,3-diamine;hydrochloride (CAS 52289-07-3) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: N'-(2-nitrophenyl)propane-1,3-diamine;hydrochloride. InChIKey: ZUGAQTRJRCXHQL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClN3O2
Molecular weight231.68 g/mol
IUPAC nameN'-(2-nitrophenyl)propane-1,3-diamine;hydrochloride
InChIKeyZUGAQTRJRCXHQL-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)NCCCN)[N+](=O)[O-].Cl

Computed by PubChem (NCBI)