CAS 802314-15-4 appears in our catalog under these names: N-(2-Methyl-4-nitrophenyl)ethane-1,2-diamine hydrochloride, 95%, N-(2-Methyl-4-nitrophenyl)ethane-1,2-diamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g.
N'-(2-methyl-4-nitrophenyl)ethane-1,2-diamine;hydrochloride (CAS 802314-15-4) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: N'-(2-methyl-4-nitrophenyl)ethane-1,2-diamine;hydrochloride. InChIKey: OOXOBKSQTAENJT-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O2 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | N'-(2-methyl-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| InChIKey | OOXOBKSQTAENJT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])NCCN.Cl |
Computed by PubChem (NCBI)