Products 855890-38-9
CAS 855890-38-9 is the registry number for N-(3,4-Dimethoxyphenyl)guanidine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
2-(3,4-dimethoxyphenyl)guanidine;hydrochloride (CAS 855890-38-9) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)guanidine;hydrochloride. InChIKey: ZEURWQZJKFZVHK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O2 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)guanidine;hydrochloride |
| InChIKey | ZEURWQZJKFZVHK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N=C(N)N)OC.Cl |
Computed by PubChem (NCBI)