CAS 1313372-75-6 appears in our catalog under these names: 3-Methyl-6-nitro-2H-indazole 95%, Pazopanib Impurity 1, 3-Methyl-6-nitro-2H-indazole, 95%, 95%. Offered by: Ambeed, Chemat Brand, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, on request, 10g.
3-methyl-6-nitro-2H-indazole (CAS 1313372-75-6) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-6-nitro-2H-indazole. InChIKey: FUNWSYKLFDLUIZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-6-nitro-2H-indazole |
| InChIKey | FUNWSYKLFDLUIZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)