Products 6494-19-5
CAS 6494-19-5 appears in our catalog under these names: 3-Methyl-6-nitroindazole, >95% (HPLC), 3–Methyl–6–nitroindazole, 3-Methyl-6-nitroindazole, >98.0%(GC), 3-Methyl-6-nitro-1H-indazole 97%, 3-Methyl-6-nitro-1H-indazole, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 1g, 100g, 5g, 25g, 50g, 250g, 500g.
3-methyl-6-nitro-2H-indazole (CAS 6494-19-5) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-6-nitro-2H-indazole. InChIKey: FUNWSYKLFDLUIZ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-6-nitro-2H-indazole |
| InChIKey | FUNWSYKLFDLUIZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)