CAS 924138-80-7 is the registry number for N-{3-((2-Methoxyphenyl)sulfamoyl)-4-methylphenyl}cyclopropanecarboxamide. Offered by: Biosynth. Available pack sizes: 2,5g.
N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]cyclopropanecarboxamide (CAS 924138-80-7) is a chemical compound with the molecular formula C18H20N2O4S and a molecular weight of 360.4 g/mol. IUPAC name: N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]cyclopropanecarboxamide. InChIKey: KQPRMGGMQVEKSZ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]cyclopropanecarboxamide |
| InChIKey | KQPRMGGMQVEKSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2CC2)S(=O)(=O)NC3=CC=CC=C3OC |
Computed by PubChem (NCBI)