CAS 32396-83-1 is the registry number for 2-(3,4-Dimethoxybenzylidene)-6-hydroxybenzofuran-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (CAS 32396-83-1) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: 2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one. InChIKey: YUCCNWHJQXNUQE-UHFFFAOYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| InChIKey | YUCCNWHJQXNUQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=C2C(=O)C3=C(O2)C=C(C=C3)O)OC |
Computed by PubChem (NCBI)