Products 1313758-93-8
CAS 1313758-93-8 appears in our catalog under these names: 6-Methyl-2-(p-tolyl)-1,3,6,2-dioxazaborocane-4,8-dione, 95%, 6-Methyl-2-(4-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
6-methyl-2-(4-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1313758-93-8) is a chemical compound with the molecular formula C12H14BNO4 and a molecular weight of 247.06 g/mol. IUPAC name: 6-methyl-2-(4-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: XXJWDGQXUAQEKD-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO4 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 6-methyl-2-(4-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | XXJWDGQXUAQEKD-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)