CAS 13141-86-1 appears in our catalog under these names: 1-(4-Nitrophenyl)-3-propylurea, 95%, N-Isopropyl-n'-(4-nitrophenyl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
1-(4-nitrophenyl)-3-propylurea (CAS 13141-86-1) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-propylurea. InChIKey: VGTBJCXVMSBEEQ-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-propylurea |
| InChIKey | VGTBJCXVMSBEEQ-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)