CAS 1437794-67-6 is the registry number for N-Butyl 5-nitropicolinamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
N-butyl-5-nitropyridine-2-carboxamide (CAS 1437794-67-6) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: N-butyl-5-nitropyridine-2-carboxamide. InChIKey: PCTHYKZDUGQVRA-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | N-butyl-5-nitropyridine-2-carboxamide |
| InChIKey | PCTHYKZDUGQVRA-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)