CAS 7146-37-4 appears in our catalog under these names: Dl-7-azatryptophan monohydrate, 95%, D,L-Azatryptophan Hydrate, >95% (HPLC), D,L–Azatryptophan hydrate, D,L-Azatryptophan hydrate, H-7-Aza-DL-Trp-OH hydrate 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10g, 1g, 250mg, 1000mg, 500mg, 2000mg, 5000mg.
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid;hydrate (CAS 7146-37-4) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid;hydrate. InChIKey: PXDRHYQAIUZKHN-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid;hydrate |
| InChIKey | PXDRHYQAIUZKHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2CC(C(=O)O)N)N=C1.O |
Computed by PubChem (NCBI)