CAS 5367-36-2 is the registry number for 2'-(N,N-Dimethylamino)-5'-nitroacetanilide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[2-(dimethylamino)-5-nitrophenyl]acetamide (CAS 5367-36-2) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: N-[2-(dimethylamino)-5-nitrophenyl]acetamide. InChIKey: TZSQCGFTOHIDIB-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | N-[2-(dimethylamino)-5-nitrophenyl]acetamide |
| InChIKey | TZSQCGFTOHIDIB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])N(C)C |
Computed by PubChem (NCBI)