Products 1314324-11-2
CAS 1314324-11-2 appears in our catalog under these names: trans–2–((1，1'–biphenyl)–4–yl)cyclopropan–1–amine hydrochloride, trans-2-([1，1'-biphenyl]-4-yl)cyclopropan-1-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
Trans-(1R,2S)-2-(4-phenylphenyl)cyclopropan-1-amine;hydrochloride (CAS 1314324-11-2) is a chemical compound with the molecular formula C15H16ClN and a molecular weight of 245.74 g/mol. IUPAC name: trans-(1R,2S)-2-(4-phenylphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: SJZYFNSAAMLGTN-LDXVYITESA-N.
| Molecular formula | C15H16ClN |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-phenylphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | SJZYFNSAAMLGTN-LDXVYITESA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)