CAS 1314655-77-0 appears in our catalog under these names: 2–(2–cyanophenyl)–2–methylpropanoic acid, 2-(2-cyanophenyl)-2-methylpropanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g, 100mg.
2-(2-cyanophenyl)-2-methylpropanoic acid (CAS 1314655-77-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(2-cyanophenyl)-2-methylpropanoic acid. InChIKey: XQRYSFCNMMHPOL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(2-cyanophenyl)-2-methylpropanoic acid |
| InChIKey | XQRYSFCNMMHPOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1C#N)C(=O)O |
Computed by PubChem (NCBI)